C23H24BrN3O3 — CID 3633990
N-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-hydroxy-2-methylphenoxy)propanamide (PubChem CID 3633990) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-hydroxy-2-methylphenoxy)propanamide.
| Compound Name | N-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-hydroxy-2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 3633990 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-hydroxy-2-methylphenoxy)propanamide |
| SMILES | Cc1cc(O)ccc1OC(C)C(=O)NN=Cc1cc(C)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C23H24BrN3O3/c1-14-11-21(28)9-10-22(14)30-17(4)23(29)26-25-13-18-12-15(2)27(16(18)3)20-7-5-19(24)6-8-20/h5-13,17,28H,1-4H3,(H,26,29) |
| InChIKey | ZNIJQUZOOTYDBQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|