C19H14N2O4 — CID 3649929
(2-phenyl-3,4-dihydropyrazol-5-yl) 2-oxochromene-3-carboxylate (PubChem CID 3649929) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is (2-phenyl-3,4-dihydropyrazol-5-yl) 2-oxochromene-3-carboxylate.
| Compound Name | (2-phenyl-3,4-dihydropyrazol-5-yl) 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 3649929 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2-phenyl-3,4-dihydropyrazol-5-yl) 2-oxochromene-3-carboxylate |
| SMILES | O=C(OC1=NN(c2ccccc2)CC1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H14N2O4/c22-18-15(12-13-6-4-5-9-16(13)24-18)19(23)25-17-10-11-21(20-17)14-7-2-1-3-8-14/h1-9,12H,10-11H2 |
| InChIKey | SJHVQKIRZCSNLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|