C22H22N4OS2 — CID 36806971
N-[3-(1H-benzimidazol-2-yl)propyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 36806971) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 36806971 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | Cc1csc(SCc2ccccc2C(=O)NCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C22H22N4OS2/c1-15-13-28-22(24-15)29-14-16-7-2-3-8-17(16)21(27)23-12-6-11-20-25-18-9-4-5-10-19(18)26-20/h2-5,7-10,13H,6,11-12,14H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | JYEQERGNOGYRLA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|