C24H28O6 — CID 3692606
4,15-bis(prop-2-enoxy)-2,6,13,17-tetraoxatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene (PubChem CID 3692606) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 4,15-bis(prop-2-enoxy)-2,6,13,17-tetraoxatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene.
| Compound Name | 4,15-bis(prop-2-enoxy)-2,6,13,17-tetraoxatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene |
|---|---|
| PubChem CID | 3692606 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4,15-bis(prop-2-enoxy)-2,6,13,17-tetraoxatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene |
| SMILES | C=CCOC1COc2ccccc2OCC(OCC=C)COc2ccccc2OC1 |
| InChI | InChI=1S/C24H28O6/c1-3-13-25-19-15-27-21-9-5-7-11-23(21)29-17-20(26-14-4-2)18-30-24-12-8-6-10-22(24)28-16-19/h3-12,19-20H,1-2,13-18H2 |
| InChIKey | FYLWDVFSZIKWHM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|