C19H19ClN4O4 — CID 3702903
N-[[4-(2-chloro-4-nitrophenoxy)phenyl]methylideneamino]-2-pyrrolidin-1-ylacetamide (PubChem CID 3702903) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is N-[[4-(2-chloro-4-nitrophenoxy)phenyl]methylideneamino]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[[4-(2-chloro-4-nitrophenoxy)phenyl]methylideneamino]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 3702903 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[[4-(2-chloro-4-nitrophenoxy)phenyl]methylideneamino]-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(CN1CCCC1)NN=Cc1ccc(Oc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClN4O4/c20-17-11-15(24(26)27)5-8-18(17)28-16-6-3-14(4-7-16)12-21-22-19(25)13-23-9-1-2-10-23/h3-8,11-12H,1-2,9-10,13H2,(H,22,25) |
| InChIKey | ZFMOCZWNDDLMAL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|