About (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole
(2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole (PubChem CID 37030033) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole.
Analyze (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole?
The IUPAC name of (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole (CID 37030033) is (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole.
What is the SMILES notation for (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole?
The canonical SMILES for (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole is CC[C@H]1N=C(C)[C@@H](C)S1.
What is the InChIKey of (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole?
The InChIKey is CSACPVARWHDAET-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H13NS/c1-4-7-8-5(2)6(3)9-7/h6-7H,4H2,1-3H3/t6-,7+/m1/s1.
What are the key properties of (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole?
(2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole has a molecular weight of 143.25 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-ethyl-4,5-dimethyl-2,5-dihydro-1,3-thiazole is sourced from PubChem (CID 37030033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).