C14H27NS — CID 6429117
4-ethyl-5-methyl-2-octyl-2,5-dihydro-1,3-thiazole (PubChem CID 6429117) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-octyl-2,5-dihydro-1,3-thiazole.
| Compound Name | 4-ethyl-5-methyl-2-octyl-2,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 6429117 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 4-ethyl-5-methyl-2-octyl-2,5-dihydro-1,3-thiazole |
| SMILES | CCCCCCCCC1N=C(CC)C(C)S1 |
| InChI | InChI=1S/C14H27NS/c1-4-6-7-8-9-10-11-14-15-13(5-2)12(3)16-14/h12,14H,4-11H2,1-3H3 |
| InChIKey | MHDROSFBIWDYEP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|