C16H27NO4S — CID 3733440
N-(1,1-dimethoxypropan-2-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 3733440) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3733440 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | COC(OC)C(C)NS(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C16H27NO4S/c1-9-10(2)12(4)15(13(5)11(9)3)22(18,19)17-14(6)16(20-7)21-8/h14,16-17H,1-8H3 |
| InChIKey | LBWCRXOACXBQHR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|