C31H40N2O2 — CID 3796549
N,1-bis(1-adamantyl)-2-(4-methylphenyl)-4-oxoazetidine-2-carboxamide (PubChem CID 3796549) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is N,1-bis(1-adamantyl)-2-(4-methylphenyl)-4-oxoazetidine-2-carboxamide.
| Compound Name | N,1-bis(1-adamantyl)-2-(4-methylphenyl)-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3796549 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | N,1-bis(1-adamantyl)-2-(4-methylphenyl)-4-oxoazetidine-2-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)NC34CC5CC(CC(C5)C3)C4)CC(=O)N2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-19-2-4-26(5-3-19)31(28(35)32-29-12-20-6-21(13-29)8-22(7-20)14-29)18-27(34)33(31)30-15-23-9-24(16-30)11-25(10-23)17-30/h2-5,20-25H,6-18H2,1H3,(H,32,35) |
| InChIKey | KAGDTWOJWPJEEO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |