C30H38N2O3 — CID 3698247
N,1-bis(1-adamantyl)-2-[2-(furan-2-yl)ethenyl]-4-oxoazetidine-2-carboxamide (PubChem CID 3698247) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is N,1-bis(1-adamantyl)-2-[2-(furan-2-yl)ethenyl]-4-oxoazetidine-2-carboxamide.
| Compound Name | N,1-bis(1-adamantyl)-2-[2-(furan-2-yl)ethenyl]-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3698247 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | N,1-bis(1-adamantyl)-2-[2-(furan-2-yl)ethenyl]-4-oxoazetidine-2-carboxamide |
| SMILES | O=C1CC(C=Cc2ccco2)(C(=O)NC23CC4CC(CC(C4)C2)C3)N1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H38N2O3/c33-26-18-30(4-3-25-2-1-5-35-25,32(26)29-15-22-9-23(16-29)11-24(10-22)17-29)27(34)31-28-12-19-6-20(13-28)8-21(7-19)14-28/h1-5,19-24H,6-18H2,(H,31,34) |
| InChIKey | JCXJVWWQGULYHR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |