C10H11N4O3+ — CID 3796853
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)pyridin-1-ium-3-ol (PubChem CID 3796853) has the molecular formula C10H11N4O3+ and a molecular weight of 235.22 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)pyridin-1-ium-3-ol.
| Compound Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)pyridin-1-ium-3-ol |
|---|---|
| PubChem CID | 3796853 |
| Molecular Formula | C10H11N4O3+ |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)pyridin-1-ium-3-ol |
| SMILES | COc1nc(OC)nc(-[n+]2cccc(O)c2)n1 |
| InChI | InChI=1S/C10H10N4O3/c1-16-9-11-8(12-10(13-9)17-2)14-5-3-4-7(15)6-14/h3-6H,1-2H3/p+1 |
| InChIKey | AQQKAGORGALTGM-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|