C14H11ClN4O — CID 44887667
1-(5-phenyl-1,2,4-triazin-3-yl)pyridin-1-ium-3-ol chloride (PubChem CID 44887667) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is 1-(5-phenyl-1,2,4-triazin-3-yl)pyridin-1-ium-3-ol chloride.
| Compound Name | 1-(5-phenyl-1,2,4-triazin-3-yl)pyridin-1-ium-3-ol chloride |
|---|---|
| PubChem CID | 44887667 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(5-phenyl-1,2,4-triazin-3-yl)pyridin-1-ium-3-ol chloride |
| SMILES | Oc1ccc[n+](-c2nncc(-c3ccccc3)n2)c1.[Cl-] |
| InChI | InChI=1S/C14H10N4O.ClH/c19-12-7-4-8-18(10-12)14-16-13(9-15-17-14)11-5-2-1-3-6-11;/h1-10H;1H |
| InChIKey | YHAFBYFJLNKHNN-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|