C21H18F3N3O3 — CID 3828089
1',6'-dimethyl-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 3828089) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 1',6'-dimethyl-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 1',6'-dimethyl-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 3828089 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1',6'-dimethyl-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)CC1(CN2C)C(=O)NC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H18F3N3O3/c1-12-6-7-16-13(8-12)10-20(11-26(16)2)17(28)25-19(30)27(18(20)29)15-5-3-4-14(9-15)21(22,23)24/h3-9H,10-11H2,1-2H3,(H,25,28,30) |
| InChIKey | CFAXCZDWLWVYAF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|