C19H22N4O6 — CID 3841137
4-[2-[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)propylideneamino]anilino]-4-oxobutanoic acid (PubChem CID 3841137) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[2-[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)propylideneamino]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)propylideneamino]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3841137 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-[2-[1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)propylideneamino]anilino]-4-oxobutanoic acid |
| SMILES | CC/C(=N\c1ccccc1NC(=O)CCC(=O)O)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H22N4O6/c1-4-11(16-17(27)22(2)19(29)23(3)18(16)28)20-12-7-5-6-8-13(12)21-14(24)9-10-15(25)26/h5-8,27H,4,9-10H2,1-3H3,(H,21,24)(H,25,26)/b20-11+ |
| InChIKey | TYJMMIUFKIOBOB-RGVLZGJSSA-N |
| XLogP | 1.12 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|