C13H22ClN3O4S — CID 3856769
2-butoxy-N-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-N-ethylacetamide (PubChem CID 3856769) has the molecular formula C13H22ClN3O4S and a molecular weight of 351.86 g/mol. Its IUPAC name is 2-butoxy-N-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-N-ethylacetamide.
| Compound Name | 2-butoxy-N-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-N-ethylacetamide |
|---|---|
| PubChem CID | 3856769 |
| Molecular Formula | C13H22ClN3O4S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-butoxy-N-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-N-ethylacetamide |
| SMILES | CCCCOCC(=O)N(CC)S(=O)(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H22ClN3O4S/c1-5-7-8-21-9-11(18)17(6-2)22(19,20)12-10(3)15-16(4)13(12)14/h5-9H2,1-4H3 |
| InChIKey | WQFHBIIWFLNBLA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|