C14H10Cl2N2OS — CID 38907391
N-(3-cyanothiophen-2-yl)-3-(2,3-dichlorophenyl)propanamide (PubChem CID 38907391) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-(2,3-dichlorophenyl)propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-(2,3-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 38907391 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-(2,3-dichlorophenyl)propanamide |
| SMILES | N#Cc1ccsc1NC(=O)CCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-11-3-1-2-9(13(11)16)4-5-12(19)18-14-10(8-17)6-7-20-14/h1-3,6-7H,4-5H2,(H,18,19) |
| InChIKey | SBEYFMOPEOLTOB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |