C14H18N5O5+ — CID 38988675
[(2S)-3-(6-acetamido-7H-purin-3-ium-3-yl)-2-acetyloxypropyl] acetate (PubChem CID 38988675) has the molecular formula C14H18N5O5+ and a molecular weight of 336.33 g/mol. Its IUPAC name is [(2S)-3-(6-acetamido-7H-purin-3-ium-3-yl)-2-acetyloxypropyl] acetate.
| Compound Name | [(2S)-3-(6-acetamido-7H-purin-3-ium-3-yl)-2-acetyloxypropyl] acetate |
|---|---|
| PubChem CID | 38988675 |
| Molecular Formula | C14H18N5O5+ |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [(2S)-3-(6-acetamido-7H-purin-3-ium-3-yl)-2-acetyloxypropyl] acetate |
| SMILES | CC(=O)Nc1nc[n+](C[C@@H](COC(C)=O)OC(C)=O)c2nc[nH]c12 |
| InChI | InChI=1S/C14H17N5O5/c1-8(20)18-13-12-14(16-6-15-12)19(7-17-13)4-11(24-10(3)22)5-23-9(2)21/h6-7,11H,4-5H2,1-3H3,(H,15,16,18,20)/p+1/t11-/m0/s1 |
| InChIKey | RRSZHDSWTSGDPT-NSHDSACASA-O |
| XLogP | -0.30 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|