C27H23N3O5 — CID 39000943
N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 39000943) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 39000943 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3cccc(OCc4cccc(C#N)c4)c3)cc2C1=O |
| InChI | InChI=1S/C27H23N3O5/c1-34-12-4-11-30-26(32)23-10-9-20(14-24(23)27(30)33)25(31)29-21-7-3-8-22(15-21)35-17-19-6-2-5-18(13-19)16-28/h2-3,5-10,13-15H,4,11-12,17H2,1H3,(H,29,31) |
| InChIKey | OGOMSQCLNWUOHZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|