C22H15Cl2NO7 — CID 3952864
4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 3952864) has the molecular formula C22H15Cl2NO7 and a molecular weight of 476.27 g/mol. Its IUPAC name is 4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3952864 |
| Molecular Formula | C22H15Cl2NO7 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(C2=NC(=Cc3coc4c(Cl)cc(Cl)cc4c3=O)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C22H15Cl2NO7/c1-28-16-5-10(6-17(29-2)20(16)30-3)21-25-15(22(27)32-21)4-11-9-31-19-13(18(11)26)7-12(23)8-14(19)24/h4-9H,1-3H3 |
| InChIKey | CBMFEYCHFXDTMV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|