C26H23N3O5S2 — CID 3962805
3-(4-morpholin-4-ylsulfonylphenyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 3962805) has the molecular formula C26H23N3O5S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3962805 |
| Molecular Formula | C26H23N3O5S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1nc2ccc(Oc3ccccc3)cc2s1 |
| InChI | InChI=1S/C26H23N3O5S2/c30-25(13-8-19-6-10-22(11-7-19)36(31,32)29-14-16-33-17-15-29)28-26-27-23-12-9-21(18-24(23)35-26)34-20-4-2-1-3-5-20/h1-13,18H,14-17H2,(H,27,28,30) |
| InChIKey | BIBKAKHFFRIOIG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|