C27H32N6O3S — CID 3975745
[2-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 3975745) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is [2-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 3975745 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [2-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccccc1C=NNc1cc(N2CCCCC2)nc(N2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H32N6O3S/c34-37(35,23-13-4-1-5-14-23)36-24-15-7-6-12-22(24)21-28-31-25-20-26(32-16-8-2-9-17-32)30-27(29-25)33-18-10-3-11-19-33/h1,4-7,12-15,20-21H,2-3,8-11,16-19H2,(H,29,30,31) |
| InChIKey | ALLSBOVDSGLGPE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|