C21H26Cl2N6 — CID 2853645
N-[(2,4-dichlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine (PubChem CID 2853645) has the molecular formula C21H26Cl2N6 and a molecular weight of 433.39 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 2853645 |
| Molecular Formula | C21H26Cl2N6 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| SMILES | Clc1ccc(C=NNc2cc(N3CCCCC3)nc(N3CCCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C21H26Cl2N6/c22-17-8-7-16(18(23)13-17)15-24-27-19-14-20(28-9-3-1-4-10-28)26-21(25-19)29-11-5-2-6-12-29/h7-8,13-15H,1-6,9-12H2,(H,25,26,27) |
| InChIKey | RAPFYZQGSFHFIZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|