C19H22Cl2N6 — CID 5340691
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 5340691) has the molecular formula C19H22Cl2N6 and a molecular weight of 405.33 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 5340691 |
| Molecular Formula | C19H22Cl2N6 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,6-dipyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | Clc1ccc(/C=N/Nc2cc(N3CCCC3)nc(N3CCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N6/c20-15-6-5-14(16(21)11-15)13-22-25-17-12-18(26-7-1-2-8-26)24-19(23-17)27-9-3-4-10-27/h5-6,11-13H,1-4,7-10H2,(H,23,24,25)/b22-13+ |
| InChIKey | ORNQFNXYKGHUSS-LPYMAVHISA-N |
| XLogP | 4.43 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|