C31H29ClN4O5 — CID 3985680
(4-chloro-3-nitrophenyl)-[4-[5-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]methanone (PubChem CID 3985680) has the molecular formula C31H29ClN4O5 and a molecular weight of 573.05 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-[5-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-[5-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3985680 |
| Molecular Formula | C31H29ClN4O5 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-[5-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)c4ccc(Cl)c([N+](=O)[O-])c4)CC3)c(C)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H29ClN4O5/c1-20-4-9-24(10-5-20)35-21(2)26(19-28(35)22-6-11-25(41-3)12-7-22)31(38)34-16-14-33(15-17-34)30(37)23-8-13-27(32)29(18-23)36(39)40/h4-13,18-19H,14-17H2,1-3H3 |
| InChIKey | PCPXNNZXPMEGTK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|