About 4-formylbenzoate
4-formylbenzoate (PubChem CID 4289537) has the molecular formula C8H5O3-
and a molecular weight of 149.12 g/mol. Its IUPAC name is 4-formylbenzoate.
Molecular Properties
| Compound Name | 4-formylbenzoate |
| PubChem CID | 4289537 |
| Molecular Formula | C8H5O3- |
| Molecular Weight | 149.12 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11)/p-1 |
| InChIKey | GOUHYARYYWKXHS-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.12 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzoate?
The IUPAC name of 4-formylbenzoate (CID 4289537) is 4-formylbenzoate.
What is the SMILES notation for 4-formylbenzoate?
The canonical SMILES for 4-formylbenzoate is O=Cc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-formylbenzoate?
The InChIKey is GOUHYARYYWKXHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11)/p-1.
What are the key properties of 4-formylbenzoate?
4-formylbenzoate has a molecular weight of 149.12 g/mol, XLogP of -0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzoate is sourced from PubChem (CID 4289537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).