C3H4N2O2S — CID 4035524
4,5-dihydroxy-1,3-dihydroimidazole-2-thione (PubChem CID 4035524) has the molecular formula C3H4N2O2S and a molecular weight of 132.14 g/mol. Its IUPAC name is 4,5-dihydroxy-1,3-dihydroimidazole-2-thione.
| Compound Name | 4,5-dihydroxy-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 4035524 |
| Molecular Formula | C3H4N2O2S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.00 |
| IUPAC Name | 4,5-dihydroxy-1,3-dihydroimidazole-2-thione |
| SMILES | Oc1[nH]c(=S)[nH]c1O |
| InChI | InChI=1S/C3H4N2O2S/c6-1-2(7)5-3(8)4-1/h6-7H,(H2,4,5,8) |
| InChIKey | CWMONBJPZZSHNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|