C22H27N6O4P — CID 4049794
(2-methylimidazo[1,2-a]pyridin-3-yl)-dimorpholin-4-yl-(4-nitrophenyl)imino-λ5-phosphane (PubChem CID 4049794) has the molecular formula C22H27N6O4P and a molecular weight of 470.47 g/mol. Its IUPAC name is (2-methylimidazo[1,2-a]pyridin-3-yl)-dimorpholin-4-yl-(4-nitrophenyl)imino-λ5-phosphane.
| Compound Name | (2-methylimidazo[1,2-a]pyridin-3-yl)-dimorpholin-4-yl-(4-nitrophenyl)imino-λ5-phosphane |
|---|---|
| PubChem CID | 4049794 |
| Molecular Formula | C22H27N6O4P |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2-methylimidazo[1,2-a]pyridin-3-yl)-dimorpholin-4-yl-(4-nitrophenyl)imino-λ5-phosphane |
| SMILES | Cc1nc2ccccn2c1P(=Nc1ccc([N+](=O)[O-])cc1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C22H27N6O4P/c1-18-22(27-9-3-2-4-21(27)23-18)33(25-10-14-31-15-11-25,26-12-16-32-17-13-26)24-19-5-7-20(8-6-19)28(29)30/h2-9H,10-17H2,1H3 |
| InChIKey | CFDTYTFTDSIQQJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|