C18H16N4O — CID 40537515
N-[(Z)-[(2S)-2-methyl-2H-chromen-3-yl]methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 40537515) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[(Z)-[(2S)-2-methyl-2H-chromen-3-yl]methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-[(2S)-2-methyl-2H-chromen-3-yl]methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 40537515 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[(Z)-[(2S)-2-methyl-2H-chromen-3-yl]methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | C[C@@H]1Oc2ccccc2C=C1/C=N\Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H16N4O/c1-12-14(10-13-6-2-5-9-17(13)23-12)11-19-22-18-20-15-7-3-4-8-16(15)21-18/h2-12H,1H3,(H2,20,21,22)/b19-11-/t12-/m0/s1 |
| InChIKey | CAITZHLBKUSYMH-XHEYCZLTSA-N |
| XLogP | 3.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|