C17H23N3S2 — CID 40595604
4-cyclohexyl-3-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 40595604) has the molecular formula C17H23N3S2 and a molecular weight of 333.53 g/mol. Its IUPAC name is 4-cyclohexyl-3-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-3-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 40595604 |
| Molecular Formula | C17H23N3S2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-cyclohexyl-3-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | C[C@H]1CCc2c(-c3n[nH]c(=S)n3C3CCCCC3)csc2C1 |
| InChI | InChI=1S/C17H23N3S2/c1-11-7-8-13-14(10-22-15(13)9-11)16-18-19-17(21)20(16)12-5-3-2-4-6-12/h10-12H,2-9H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | HVSARAWVVQSSLW-NSHDSACASA-N |
| XLogP | 5.30 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|