C23H21N3O3S — CID 40694493
3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40694493) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40694493 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(N3C(=O)CCC3=O)c2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C23H21N3O3S/c1-3-12-25-18-9-8-15(4-2)13-19(18)30-23(25)24-22(29)16-6-5-7-17(14-16)26-20(27)10-11-21(26)28/h3,5-9,13-14H,1,4,10-12H2,2H3/b24-23- |
| InChIKey | FCJJFWCHQDNLGM-VHXPQNKSSA-N |
| XLogP | 3.85 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|