C17H16Br2O3 — CID 40736842
(2,5-dimethylphenyl) (2R)-2-(2,4-dibromophenoxy)propanoate (PubChem CID 40736842) has the molecular formula C17H16Br2O3 and a molecular weight of 428.12 g/mol. Its IUPAC name is (2,5-dimethylphenyl) (2R)-2-(2,4-dibromophenoxy)propanoate.
| Compound Name | (2,5-dimethylphenyl) (2R)-2-(2,4-dibromophenoxy)propanoate |
|---|---|
| PubChem CID | 40736842 |
| Molecular Formula | C17H16Br2O3 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | (2,5-dimethylphenyl) (2R)-2-(2,4-dibromophenoxy)propanoate |
| SMILES | Cc1ccc(C)c(OC(=O)[C@@H](C)Oc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C17H16Br2O3/c1-10-4-5-11(2)16(8-10)22-17(20)12(3)21-15-7-6-13(18)9-14(15)19/h4-9,12H,1-3H3/t12-/m1/s1 |
| InChIKey | PSJUMYYWCXSGNN-GFCCVEGCSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|