C22H16Cl2N2O3S — CID 40844525
(5S)-5-benzyl-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 40844525) has the molecular formula C22H16Cl2N2O3S and a molecular weight of 459.35 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40844525 |
| Molecular Formula | C22H16Cl2N2O3S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (5S)-5-benzyl-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)N[C@@](Cc2ccccc2)(c2ccccc2)C1=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C22H16Cl2N2O3S/c23-18-11-16(19(24)30-18)17(27)13-26-20(28)22(25-21(26)29,15-9-5-2-6-10-15)12-14-7-3-1-4-8-14/h1-11H,12-13H2,(H,25,29)/t22-/m0/s1 |
| InChIKey | SIKJLPRAIMKFEZ-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|