C20H22N4O5S — CID 40868925
N-(2-tert-butyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 40868925) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-(2-tert-butyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(2-tert-butyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 40868925 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-(2-tert-butyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C)(C)n1nc2c(c1NC(=O)CCN1C(=O)c3ccccc3C1=O)CS(=O)(=O)C2 |
| InChI | InChI=1S/C20H22N4O5S/c1-20(2,3)24-17(14-10-30(28,29)11-15(14)22-24)21-16(25)8-9-23-18(26)12-6-4-5-7-13(12)19(23)27/h4-7H,8-11H2,1-3H3,(H,21,25) |
| InChIKey | POHYCTMXONEVFS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|