C26H21N5O4 — CID 40894014
[(1S,2R,3S,3aS)-2-(4-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(benzotriazol-1-yl)methanone (PubChem CID 40894014) has the molecular formula C26H21N5O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is [(1S,2R,3S,3aS)-2-(4-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(benzotriazol-1-yl)methanone.
| Compound Name | [(1S,2R,3S,3aS)-2-(4-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(benzotriazol-1-yl)methanone |
|---|---|
| PubChem CID | 40894014 |
| Molecular Formula | C26H21N5O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [(1S,2R,3S,3aS)-2-(4-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(benzotriazol-1-yl)methanone |
| SMILES | COc1ccc([C@H]2[C@H]([N+](=O)[O-])[C@@H]3C=Cc4ccccc4N3[C@@H]2C(=O)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C26H21N5O4/c1-35-18-13-10-17(11-14-18)23-24(31(33)34)22-15-12-16-6-2-4-8-20(16)29(22)25(23)26(32)30-21-9-5-3-7-19(21)27-28-30/h2-15,22-25H,1H3/t22-,23-,24+,25-/m0/s1 |
| InChIKey | OGWHSRIFGMCRDG-JBXUNAHCSA-N |
| XLogP | 3.79 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|