C27H18FN5O3 — CID 40937834
(10S,11S,15S,16S)-16-(benzotriazole-1-carbonyl)-13-(2-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 40937834) has the molecular formula C27H18FN5O3 and a molecular weight of 479.47 g/mol. Its IUPAC name is (10S,11S,15S,16S)-16-(benzotriazole-1-carbonyl)-13-(2-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11S,15S,16S)-16-(benzotriazole-1-carbonyl)-13-(2-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 40937834 |
| Molecular Formula | C27H18FN5O3 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (10S,11S,15S,16S)-16-(benzotriazole-1-carbonyl)-13-(2-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1F)[C@@H]1C=Cc3ccccc3N1[C@@H]2C(=O)n1nnc2ccccc21 |
| InChI | InChI=1S/C27H18FN5O3/c28-16-8-2-5-11-19(16)32-25(34)22-21-14-13-15-7-1-4-10-18(15)31(21)24(23(22)26(32)35)27(36)33-20-12-6-3-9-17(20)29-30-33/h1-14,21-24H/t21-,22+,23-,24-/m0/s1 |
| InChIKey | FHZFSVQHORGVGB-KIHHCIJBSA-N |
| XLogP | 3.30 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|