C28H21N5O4 — CID 5162854
16-(benzotriazole-1-carbonyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 5162854) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is 16-(benzotriazole-1-carbonyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 16-(benzotriazole-1-carbonyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 5162854 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 16-(benzotriazole-1-carbonyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc(N2C(=O)C3C(C2=O)C(C(=O)n2nnc4ccccc42)N2c4ccccc4C=CC32)cc1 |
| InChI | InChI=1S/C28H21N5O4/c1-37-18-13-11-17(12-14-18)31-26(34)23-22-15-10-16-6-2-4-8-20(16)32(22)25(24(23)27(31)35)28(36)33-21-9-5-3-7-19(21)29-30-33/h2-15,22-25H,1H3 |
| InChIKey | UDPHJNHLIVIVLF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|