C28H18F3N5O3 — CID 3825248
16-(benzotriazole-1-carbonyl)-13-[3-(trifluoromethyl)phenyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 3825248) has the molecular formula C28H18F3N5O3 and a molecular weight of 529.48 g/mol. Its IUPAC name is 16-(benzotriazole-1-carbonyl)-13-[3-(trifluoromethyl)phenyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 16-(benzotriazole-1-carbonyl)-13-[3-(trifluoromethyl)phenyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3825248 |
| Molecular Formula | C28H18F3N5O3 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 16-(benzotriazole-1-carbonyl)-13-[3-(trifluoromethyl)phenyl]-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C1C2C(C(=O)N1c1cccc(C(F)(F)F)c1)C(C(=O)n1nnc3ccccc31)N1c3ccccc3C=CC21 |
| InChI | InChI=1S/C28H18F3N5O3/c29-28(30,31)16-7-5-8-17(14-16)34-25(37)22-21-13-12-15-6-1-3-10-19(15)35(21)24(23(22)26(34)38)27(39)36-20-11-4-2-9-18(20)32-33-36/h1-14,21-24H |
| InChIKey | DALKPDWSIKEYEL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|