C18H13Cl3N2O4S — CID 40910245
2-(2,4-dichlorophenoxy)ethyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 40910245) has the molecular formula C18H13Cl3N2O4S and a molecular weight of 459.74 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 40910245 |
| Molecular Formula | C18H13Cl3N2O4S |
| Molecular Weight | 459.74 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)OCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl3N2O4S/c19-12-3-1-11(2-4-12)17-22-23-18(27-17)28-10-16(24)26-8-7-25-15-6-5-13(20)9-14(15)21/h1-6,9H,7-8,10H2 |
| InChIKey | SVZXQNJZDGLUDL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|