C39H47ClFNO5S — CID 4100621
ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 4100621) has the molecular formula C39H47ClFNO5S and a molecular weight of 696.33 g/mol. Its IUPAC name is ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 4100621 |
| Molecular Formula | C39H47ClFNO5S |
| Molecular Weight | 696.33 g/mol |
| Exact Mass | 695.28 |
| IUPAC Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CCOC(=O)N(CCc1cccs1)CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C39H47ClFNO5S/c1-4-47-37(45)42(20-17-29-9-7-21-48-29)25-39(46)19-16-33-30-15-13-27(22-28(43)14-12-26(2)8-6-18-38(33,39)3)23-31(30)36(44)24-32-34(40)10-5-11-35(32)41/h5,7-11,13,15,21,23,28,33,43,46H,4,6,12,14,16-20,22,24-25H2,1-3H3 |
| InChIKey | HKUMTVDTPBSFLV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.33 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|