C24H33N3O4S — CID 4103075
N,1-dibutyl-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole-5-sulfonamide (PubChem CID 4103075) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N,1-dibutyl-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole-5-sulfonamide.
| Compound Name | N,1-dibutyl-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 4103075 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N,1-dibutyl-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2c(c1)nc(Cc1ccc(OC)c(OC)c1)n2CCCC |
| InChI | InChI=1S/C24H33N3O4S/c1-5-7-13-25-32(28,29)19-10-11-21-20(17-19)26-24(27(21)14-8-6-2)16-18-9-12-22(30-3)23(15-18)31-4/h9-12,15,17,25H,5-8,13-14,16H2,1-4H3 |
| InChIKey | BFFZDAASXOBKHP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|