C20H15BrN2O5 — CID 4119049
[4-bromo-2-[[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 4119049) has the molecular formula C20H15BrN2O5 and a molecular weight of 443.25 g/mol. Its IUPAC name is [4-bromo-2-[[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-bromo-2-[[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4119049 |
| Molecular Formula | C20H15BrN2O5 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | [4-bromo-2-[[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1C=NNC(=O)C(O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H15BrN2O5/c21-15-8-9-16(28-20(26)17-7-4-10-27-17)14(11-15)12-22-23-19(25)18(24)13-5-2-1-3-6-13/h1-12,18,24H,(H,23,25) |
| InChIKey | NDUCKXIMOHIJLN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|