C13H19N5O3 — CID 41260493
N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 41260493) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 41260493 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)N[C@@](C)(C#N)C(C)C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N5O3/c1-8(2)13(5,7-14)15-11(19)6-17-10(4)12(18(20)21)9(3)16-17/h8H,6H2,1-5H3,(H,15,19)/t13-/m0/s1 |
| InChIKey | QUGYLMPUVBWQGL-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|