C21H24Cl2N2O — CID 4162172
N-[(2,2-dichloro-3-phenylcyclopropyl)methylideneamino]adamantane-1-carboxamide (PubChem CID 4162172) has the molecular formula C21H24Cl2N2O and a molecular weight of 391.34 g/mol. Its IUPAC name is N-[(2,2-dichloro-3-phenylcyclopropyl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(2,2-dichloro-3-phenylcyclopropyl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4162172 |
| Molecular Formula | C21H24Cl2N2O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[(2,2-dichloro-3-phenylcyclopropyl)methylideneamino]adamantane-1-carboxamide |
| SMILES | O=C(NN=CC1C(c2ccccc2)C1(Cl)Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24Cl2N2O/c22-21(23)17(18(21)16-4-2-1-3-5-16)12-24-25-19(26)20-9-13-6-14(10-20)8-15(7-13)11-20/h1-5,12-15,17-18H,6-11H2,(H,25,26) |
| InChIKey | GAYPBUINOVKSHD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|