C15H18N2O4S — CID 4166421
1-ethyl-5-morpholin-4-ylsulfonylindole-3-carbaldehyde (PubChem CID 4166421) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-ethyl-5-morpholin-4-ylsulfonylindole-3-carbaldehyde.
| Compound Name | 1-ethyl-5-morpholin-4-ylsulfonylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 4166421 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-ethyl-5-morpholin-4-ylsulfonylindole-3-carbaldehyde |
| SMILES | CCn1cc(C=O)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C15H18N2O4S/c1-2-16-10-12(11-18)14-9-13(3-4-15(14)16)22(19,20)17-5-7-21-8-6-17/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | ICBQIDYORLSAGM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|