C24H20N4O2S2 — CID 4171135
4-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carbonitrile (PubChem CID 4171135) has the molecular formula C24H20N4O2S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carbonitrile.
| Compound Name | 4-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carbonitrile |
|---|---|
| PubChem CID | 4171135 |
| Molecular Formula | C24H20N4O2S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 4-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carbonitrile |
| SMILES | Cc1ccc(Sc2ccc(C=Nc3sc4c(c3C#N)C3CCN4CC3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N4O2S2/c1-15-2-5-18(6-3-15)31-21-7-4-16(12-20(21)28(29)30)14-26-23-19(13-25)22-17-8-10-27(11-9-17)24(22)32-23/h2-7,12,14,17H,8-11H2,1H3 |
| InChIKey | SSUMNNXSWKLTJI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|