C27H22ClN5OS — CID 4180719
4-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-phenyl-1,3-thiazol-3-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 4180719) has the molecular formula C27H22ClN5OS and a molecular weight of 500.03 g/mol. Its IUPAC name is 4-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-phenyl-1,3-thiazol-3-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-phenyl-1,3-thiazol-3-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4180719 |
| Molecular Formula | C27H22ClN5OS |
| Molecular Weight | 500.03 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 4-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-phenyl-1,3-thiazol-3-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(-n2c(-c3ccccc3)csc2=NN=Cc2ccccc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H22ClN5OS/c1-19-25(26(34)33(31(19)2)22-14-7-4-8-15-22)32-24(20-11-5-3-6-12-20)18-35-27(32)30-29-17-21-13-9-10-16-23(21)28/h3-18H,1-2H3 |
| InChIKey | LARVJBUXMSAFPC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.03 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|