C13H8Cl3NO2S — CID 4200802
S-(4-hydroxyphenyl) N-(2,4,5-trichlorophenyl)carbamothioate (PubChem CID 4200802) has the molecular formula C13H8Cl3NO2S and a molecular weight of 348.64 g/mol. Its IUPAC name is S-(4-hydroxyphenyl) N-(2,4,5-trichlorophenyl)carbamothioate.
| Compound Name | S-(4-hydroxyphenyl) N-(2,4,5-trichlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 4200802 |
| Molecular Formula | C13H8Cl3NO2S |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | S-(4-hydroxyphenyl) N-(2,4,5-trichlorophenyl)carbamothioate |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)Sc1ccc(O)cc1 |
| InChI | InChI=1S/C13H8Cl3NO2S/c14-9-5-11(16)12(6-10(9)15)17-13(19)20-8-3-1-7(18)2-4-8/h1-6,18H,(H,17,19) |
| InChIKey | YIQAZPBZIUAFRU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|