C28H26Cl2N4NiO2 — CID 4201457
bis(4-chloro-2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel (PubChem CID 4201457) has the molecular formula C28H26Cl2N4NiO2 and a molecular weight of 580.14 g/mol. Its IUPAC name is bis(4-chloro-2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel.
| Compound Name | bis(4-chloro-2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel |
|---|---|
| PubChem CID | 4201457 |
| Molecular Formula | C28H26Cl2N4NiO2 |
| Molecular Weight | 580.14 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | bis(4-chloro-2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel |
| SMILES | Cc1cccc(C/N=C/c2cc(Cl)ccc2O)n1.Cc1cccc(CN=Cc2cc(Cl)ccc2O)n1.[Ni] |
| InChI | InChI=1S/2C14H13ClN2O.Ni/c2*1-10-3-2-4-13(17-10)9-16-8-11-7-12(15)5-6-14(11)18;/h2*2-8,18H,9H2,1H3;/b16-8+;; |
| InChIKey | XDJBFZBCCGDEHT-RFZNCAAWSA-N |
| XLogP | 6.73 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.14 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|