C28H28N4NiO4 — CID 5108988
bis(4-[(6-methyl-2-pyridinyl)methyliminomethyl]benzene-1,3-diol);nickel (PubChem CID 5108988) has the molecular formula C28H28N4NiO4 and a molecular weight of 543.25 g/mol. Its IUPAC name is bis(4-[(6-methyl-2-pyridinyl)methyliminomethyl]benzene-1,3-diol);nickel.
| Compound Name | bis(4-[(6-methyl-2-pyridinyl)methyliminomethyl]benzene-1,3-diol);nickel |
|---|---|
| PubChem CID | 5108988 |
| Molecular Formula | C28H28N4NiO4 |
| Molecular Weight | 543.25 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | bis(4-[(6-methyl-2-pyridinyl)methyliminomethyl]benzene-1,3-diol);nickel |
| SMILES | Cc1cccc(C/N=C/c2ccc(O)cc2O)n1.Cc1cccc(CN=Cc2ccc(O)cc2O)n1.[Ni] |
| InChI | InChI=1S/2C14H14N2O2.Ni/c2*1-10-3-2-4-12(16-10)9-15-8-11-5-6-13(17)7-14(11)18;/h2*2-8,17-18H,9H2,1H3;/b15-8+;; |
| InChIKey | BGNXDKKBZGAZAF-OLIKVXRNSA-N |
| XLogP | 4.84 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|