C21H23ClN4O4S — CID 4211136
1-(3-chlorophenyl)sulfonyl-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzimidazol-2-one (PubChem CID 4211136) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzimidazol-2-one.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 4211136 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzimidazol-2-one |
| SMILES | CCN1CCN(C(=O)Cn2c(=O)n(S(=O)(=O)c3cccc(Cl)c3)c3ccccc32)CC1 |
| InChI | InChI=1S/C21H23ClN4O4S/c1-2-23-10-12-24(13-11-23)20(27)15-25-18-8-3-4-9-19(18)26(21(25)28)31(29,30)17-7-5-6-16(22)14-17/h3-9,14H,2,10-13,15H2,1H3 |
| InChIKey | IECOVPFPRMXMEM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |